About 2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine
2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine (PubChem CID 89138477) has the molecular formula C10H11NS2
and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine.
Analyze 2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine?
The IUPAC name of 2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine (CID 89138477) is 2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine.
What is the SMILES notation for 2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine?
The canonical SMILES for 2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine is C=C1SCCNc2ccccc2S1.
What is the InChIKey of 2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine?
The InChIKey is AUNRWHQODRACIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS2/c1-8-12-7-6-11-9-4-2-3-5-10(9)13-8/h2-5,11H,1,6-7H2.
What are the key properties of 2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine?
2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine has a molecular weight of 209.34 g/mol, XLogP of 3.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-5,6-dihydro-4H-1,3,6-benzodithiazocine is sourced from PubChem (CID 89138477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).