About N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine
N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine (PubChem CID 89138641) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine.
Molecular Properties
| Compound Name | N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine |
| PubChem CID | 89138641 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C=C\C(C)C=C |
| InChI | InChI=1S/C9H13N/c1-4-7-10-8-6-9(3)5-2/h4-9H,1-2H2,3H3/b8-6-,10-7+ |
| InChIKey | CNHRHJHUXKUNNA-GOOBONSCSA-N |
| XLogP | 2.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine?
The IUPAC name of N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine (CID 89138641) is N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine.
What is the SMILES notation for N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine?
The canonical SMILES for N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine is C=C/C=N/C=C\C(C)C=C.
What is the InChIKey of N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine?
The InChIKey is CNHRHJHUXKUNNA-GOOBONSCSA-N. The full InChI is InChI=1S/C9H13N/c1-4-7-10-8-6-9(3)5-2/h4-9H,1-2H2,3H3/b8-6-,10-7+.
What are the key properties of N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine?
N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine has a molecular weight of 135.21 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-3-methylpenta-1,4-dienyl]prop-2-en-1-imine is sourced from PubChem (CID 89138641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).