About 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one
2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one (PubChem CID 89138857) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one.
Molecular Properties
| Compound Name | 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one |
| PubChem CID | 89138857 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one |
| SMILES | O=C1OC2=C(O)C3CC1C2C3 |
| InChI | InChI=1S/C8H8O3/c9-6-3-1-4-5(2-3)8(10)11-7(4)6/h3-5,9H,1-2H2 |
| InChIKey | QABMBKUJKTYPMN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one?
The IUPAC name of 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one (CID 89138857) is 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one.
What is the SMILES notation for 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one?
The canonical SMILES for 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one is O=C1OC2=C(O)C3CC1C2C3.
What is the InChIKey of 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one?
The InChIKey is QABMBKUJKTYPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c9-6-3-1-4-5(2-3)8(10)11-7(4)6/h3-5,9H,1-2H2.
What are the key properties of 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one?
2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one has a molecular weight of 152.15 g/mol, XLogP of 0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-oxatricyclo[4.2.1.03,7]non-2-en-5-one is sourced from PubChem (CID 89138857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).