C15H16F8O2 — CID 89138982
(3,3,4,4,5,5,6,6-octafluoro-2-methylhexan-2-yl) bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 89138982) has the molecular formula C15H16F8O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6-octafluoro-2-methylhexan-2-yl) bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (3,3,4,4,5,5,6,6-octafluoro-2-methylhexan-2-yl) bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 89138982 |
| Molecular Formula | C15H16F8O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (3,3,4,4,5,5,6,6-octafluoro-2-methylhexan-2-yl) bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)(OC(=O)C1CC2C=CC1C2)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H16F8O2/c1-12(2,14(20,21)15(22,23)13(18,19)11(16)17)25-10(24)9-6-7-3-4-8(9)5-7/h3-4,7-9,11H,5-6H2,1-2H3 |
| InChIKey | KTOAPBQBICXBAV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|