C9H9F7O — CID 89138985
1,1,1,3,3,3-hexafluoro-2-(1-fluorocyclohex-3-en-1-yl)propan-2-ol (PubChem CID 89138985) has the molecular formula C9H9F7O and a molecular weight of 266.16 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(1-fluorocyclohex-3-en-1-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(1-fluorocyclohex-3-en-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 89138985 |
| Molecular Formula | C9H9F7O |
| Molecular Weight | 266.16 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(1-fluorocyclohex-3-en-1-yl)propan-2-ol |
| SMILES | OC(C(F)(F)F)(C(F)(F)F)C1(F)CC=CCC1 |
| InChI | InChI=1S/C9H9F7O/c10-6(4-2-1-3-5-6)7(17,8(11,12)13)9(14,15)16/h1-2,17H,3-5H2 |
| InChIKey | TXLSSZBHYODDDX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.16 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|