C34H42F3N3O5 — CID 89139077
[(1S,3R)-3-[6-(benzylperoxymethyl)-3-azabicyclo[3.2.1]octan-3-yl]-1-propan-2-ylcyclopentyl]-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 89139077) has the molecular formula C34H42F3N3O5 and a molecular weight of 629.72 g/mol. Its IUPAC name is [(1S,3R)-3-[6-(benzylperoxymethyl)-3-azabicyclo[3.2.1]octan-3-yl]-1-propan-2-ylcyclopentyl]-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | [(1S,3R)-3-[6-(benzylperoxymethyl)-3-azabicyclo[3.2.1]octan-3-yl]-1-propan-2-ylcyclopentyl]-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 89139077 |
| Molecular Formula | C34H42F3N3O5 |
| Molecular Weight | 629.72 g/mol |
| Exact Mass | 629.31 |
| IUPAC Name | [(1S,3R)-3-[6-(benzylperoxymethyl)-3-azabicyclo[3.2.1]octan-3-yl]-1-propan-2-ylcyclopentyl]-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | CC(C)[C@]1(C(=O)N2CCc3c(cc(C(F)(F)F)cc3[N+](=O)[O-])C2)CC[C@@H](N2CC3CC(COOCc4ccccc4)C(C3)C2)C1 |
| InChI | InChI=1S/C34H42F3N3O5/c1-22(2)33(32(41)38-11-9-30-26(19-38)14-28(34(35,36)37)15-31(30)40(42)43)10-8-29(16-33)39-17-24-12-25(18-39)27(13-24)21-45-44-20-23-6-4-3-5-7-23/h3-7,14-15,22,24-25,27,29H,8-13,16-21H2,1-2H3/t24?,25?,27?,29-,33+/m1/s1 |
| InChIKey | UMKJFOHJBJYWRQ-PAGWLVISSA-N |
| XLogP | 6.80 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.72 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|