C39H49N7O6 — CID 89139130
2-phenylethyl 1-[[(2S,4R)-1-[(2S)-2-(cyclopentyloxycarbonylamino)non-8-enoyl]-4-(5-phenyltetrazol-2-yl)pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate (PubChem CID 89139130) has the molecular formula C39H49N7O6 and a molecular weight of 711.86 g/mol. Its IUPAC name is 2-phenylethyl 1-[[(2S,4R)-1-[(2S)-2-(cyclopentyloxycarbonylamino)non-8-enoyl]-4-(5-phenyltetrazol-2-yl)pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate.
| Compound Name | 2-phenylethyl 1-[[(2S,4R)-1-[(2S)-2-(cyclopentyloxycarbonylamino)non-8-enoyl]-4-(5-phenyltetrazol-2-yl)pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 89139130 |
| Molecular Formula | C39H49N7O6 |
| Molecular Weight | 711.86 g/mol |
| Exact Mass | 711.37 |
| IUPAC Name | 2-phenylethyl 1-[[(2S,4R)-1-[(2S)-2-(cyclopentyloxycarbonylamino)non-8-enoyl]-4-(5-phenyltetrazol-2-yl)pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate |
| SMILES | C=CCCCCC[C@H](NC(=O)OC1CCCC1)C(=O)N1C[C@H](n2nnc(-c3ccccc3)n2)C[C@H]1C(=O)NC1(C(=O)OCCc2ccccc2)CC1 |
| InChI | InChI=1S/C39H49N7O6/c1-2-3-4-5-12-21-32(40-38(50)52-31-19-13-14-20-31)36(48)45-27-30(46-43-34(42-44-46)29-17-10-7-11-18-29)26-33(45)35(47)41-39(23-24-39)37(49)51-25-22-28-15-8-6-9-16-28/h2,6-11,15-18,30-33H,1,3-5,12-14,19-27H2,(H,40,50)(H,41,47)/t30-,32+,33+/m1/s1 |
| InChIKey | VGAPUGSGXLTAOL-JXFVGPSASA-N |
| XLogP | 5.09 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.86 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|