C54H41N — CID 89139267
N-[(E)-1-[10-(9,9-dimethyl-5,6-dihydrofluoren-3-yl)-3-naphthalen-1-ylanthracen-9-yl]-2-phenylethenyl]-6-methylidenecyclohexa-2,4-dien-1-imine (PubChem CID 89139267) has the molecular formula C54H41N and a molecular weight of 703.93 g/mol. Its IUPAC name is N-[(E)-1-[10-(9,9-dimethyl-5,6-dihydrofluoren-3-yl)-3-naphthalen-1-ylanthracen-9-yl]-2-phenylethenyl]-6-methylidenecyclohexa-2,4-dien-1-imine.
| Compound Name | N-[(E)-1-[10-(9,9-dimethyl-5,6-dihydrofluoren-3-yl)-3-naphthalen-1-ylanthracen-9-yl]-2-phenylethenyl]-6-methylidenecyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 89139267 |
| Molecular Formula | C54H41N |
| Molecular Weight | 703.93 g/mol |
| Exact Mass | 703.32 |
| IUPAC Name | N-[(E)-1-[10-(9,9-dimethyl-5,6-dihydrofluoren-3-yl)-3-naphthalen-1-ylanthracen-9-yl]-2-phenylethenyl]-6-methylidenecyclohexa-2,4-dien-1-imine |
| SMILES | C=C1C=CC=C/C1=N\C(=C\c1ccccc1)c1c2ccccc2c(-c2ccc3c(c2)C2=C(C=CCC2)C3(C)C)c2cc(-c3cccc4ccccc34)ccc12 |
| InChI | InChI=1S/C54H41N/c1-35-16-7-14-27-50(35)55-51(32-36-17-5-4-6-18-36)53-44-24-11-10-23-43(44)52(39-29-31-49-46(34-39)42-22-12-13-26-48(42)54(49,2)3)47-33-38(28-30-45(47)53)41-25-15-20-37-19-8-9-21-40(37)41/h4-11,13-21,23-34H,1,12,22H2,2-3H3/b51-32+,55-50+ |
| InChIKey | NUGZSZZCFORLRZ-SKDWBTSUSA-N |
| XLogP | 14.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.93 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|