C23H38F3NO — CID 89139444
7-[3-prop-2-enyl-2-propyl-4-(1,1,1-trifluoro-2-methylpropan-2-yl)cyclohexa-1,5-dien-1-yl]oxyheptan-1-amine (PubChem CID 89139444) has the molecular formula C23H38F3NO and a molecular weight of 401.56 g/mol. Its IUPAC name is 7-[3-prop-2-enyl-2-propyl-4-(1,1,1-trifluoro-2-methylpropan-2-yl)cyclohexa-1,5-dien-1-yl]oxyheptan-1-amine.
| Compound Name | 7-[3-prop-2-enyl-2-propyl-4-(1,1,1-trifluoro-2-methylpropan-2-yl)cyclohexa-1,5-dien-1-yl]oxyheptan-1-amine |
|---|---|
| PubChem CID | 89139444 |
| Molecular Formula | C23H38F3NO |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | 7-[3-prop-2-enyl-2-propyl-4-(1,1,1-trifluoro-2-methylpropan-2-yl)cyclohexa-1,5-dien-1-yl]oxyheptan-1-amine |
| SMILES | C=CCC1C(CCC)=C(OCCCCCCCN)C=CC1C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C23H38F3NO/c1-5-12-18-19(13-6-2)21(28-17-11-9-7-8-10-16-27)15-14-20(18)22(3,4)23(24,25)26/h5,14-15,18,20H,1,6-13,16-17,27H2,2-4H3 |
| InChIKey | QOWNTNTUICFNFM-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|