C19H33N5 — CID 89139481
(1E,3Z)-2-[[[(3Z,5E)-6-amino-5-(propylamino)hexa-1,3,5-trien-2-yl]amino]methyl]-5-N-propylhexa-1,3,5-triene-1,5-diamine (PubChem CID 89139481) has the molecular formula C19H33N5 and a molecular weight of 331.51 g/mol. Its IUPAC name is (1E,3Z)-2-[[[(3Z,5E)-6-amino-5-(propylamino)hexa-1,3,5-trien-2-yl]amino]methyl]-5-N-propylhexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1E,3Z)-2-[[[(3Z,5E)-6-amino-5-(propylamino)hexa-1,3,5-trien-2-yl]amino]methyl]-5-N-propylhexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 89139481 |
| Molecular Formula | C19H33N5 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | (1E,3Z)-2-[[[(3Z,5E)-6-amino-5-(propylamino)hexa-1,3,5-trien-2-yl]amino]methyl]-5-N-propylhexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C(/C=C\C(=C/N)CNC(=C)/C=C\C(=C/N)NCCC)NCCC |
| InChI | InChI=1S/C19H33N5/c1-5-11-22-16(3)7-9-18(13-20)15-24-17(4)8-10-19(14-21)23-12-6-2/h7-10,13-14,22-24H,3-6,11-12,15,20-21H2,1-2H3/b9-7-,10-8-,18-13+,19-14+ |
| InChIKey | JWYGBYZMOAMUAF-KMIOSYTKSA-N |
| XLogP | 2.36 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|