C14H13NO2 — CID 89139683
14-methoxy-6-oxa-3-azatricyclo[9.4.0.02,7]pentadeca-1,7,9,10,12,14-hexaene (PubChem CID 89139683) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 14-methoxy-6-oxa-3-azatricyclo[9.4.0.02,7]pentadeca-1,7,9,10,12,14-hexaene.
| Compound Name | 14-methoxy-6-oxa-3-azatricyclo[9.4.0.02,7]pentadeca-1,7,9,10,12,14-hexaene |
|---|---|
| PubChem CID | 89139683 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 14-methoxy-6-oxa-3-azatricyclo[9.4.0.02,7]pentadeca-1,7,9,10,12,14-hexaene |
| SMILES | COc1ccc2c(c1)=C1NCCOC1=CC=C=2 |
| InChI | InChI=1S/C14H13NO2/c1-16-11-6-5-10-3-2-4-13-14(12(10)9-11)15-7-8-17-13/h2,4-6,9,15H,7-8H2,1H3 |
| InChIKey | LBXFGVYXTDCOEK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |