C9H12F3N — CID 89140162
(2Z,4E)-5-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-amine (PubChem CID 89140162) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is (2Z,4E)-5-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4E)-5-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 89140162 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (2Z,4E)-5-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(C)=C(\C=C(\C)N)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N/c1-4-6(2)8(5-7(3)13)9(10,11)12/h4-5H,1,13H2,2-3H3/b7-5-,8-6+ |
| InChIKey | LLCDNGTXDWFBQU-CGXWXWIYSA-N |
| XLogP | 2.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|