C29H33BN6O3S — CID 89140231
CID 89140231 (PubChem CID 89140231) has the molecular formula C29H33BN6O3S and a molecular weight of 556.50 g/mol.
| Compound Name | CID 89140231 |
|---|---|
| PubChem CID | 89140231 |
| Molecular Formula | C29H33BN6O3S |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | — |
| SMILES | [B]c1c[nH]c2nc(N3c4cc(C)c(C5CCNCC5)cc4OC3C)nc(Nc3ccccc3S(=O)(=O)C(C)C)c12 |
| InChI | InChI=1S/C29H33BN6O3S/c1-16(2)40(37,38)25-8-6-5-7-22(25)33-28-26-21(30)15-32-27(26)34-29(35-28)36-18(4)39-24-14-20(17(3)13-23(24)36)19-9-11-31-12-10-19/h5-8,13-16,18-19,31H,9-12H2,1-4H3,(H2,32,33,34,35) |
| InChIKey | PFFWEPZKBUAFFP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|