C16H16N2O4 — CID 89140424
2-[(8-nitrosoquinolin-5-yl)methoxy]ethyl 2-methylprop-2-enoate (PubChem CID 89140424) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[(8-nitrosoquinolin-5-yl)methoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(8-nitrosoquinolin-5-yl)methoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89140424 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[(8-nitrosoquinolin-5-yl)methoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCc1ccc(N=O)c2ncccc12 |
| InChI | InChI=1S/C16H16N2O4/c1-11(2)16(19)22-9-8-21-10-12-5-6-14(18-20)15-13(12)4-3-7-17-15/h3-7H,1,8-10H2,2H3 |
| InChIKey | FDDURZATVPICCW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|