C20H14F2N4OS — CID 89140455
2-[2-(2,4-difluorophenyl)-1,2,4-triazol-3-yl]-4,5-dihydrothieno[3,2-d][1]benzoxepin-8-amine (PubChem CID 89140455) has the molecular formula C20H14F2N4OS and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-1,2,4-triazol-3-yl]-4,5-dihydrothieno[3,2-d][1]benzoxepin-8-amine.
| Compound Name | 2-[2-(2,4-difluorophenyl)-1,2,4-triazol-3-yl]-4,5-dihydrothieno[3,2-d][1]benzoxepin-8-amine |
|---|---|
| PubChem CID | 89140455 |
| Molecular Formula | C20H14F2N4OS |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)-1,2,4-triazol-3-yl]-4,5-dihydrothieno[3,2-d][1]benzoxepin-8-amine |
| SMILES | Nc1ccc2c(c1)OCCc1cc(-c3ncnn3-c3ccc(F)cc3F)sc1-2 |
| InChI | InChI=1S/C20H14F2N4OS/c21-12-1-4-16(15(22)8-12)26-20(24-10-25-26)18-7-11-5-6-27-17-9-13(23)2-3-14(17)19(11)28-18/h1-4,7-10H,5-6,23H2 |
| InChIKey | IVJGUAUZXGOASQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|