About 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine
1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine (PubChem CID 89140548) has the molecular formula C10H15FN2
and a molecular weight of 182.24 g/mol. Its IUPAC name is 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine.
Molecular Properties
| Compound Name | 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine |
| PubChem CID | 89140548 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine |
| SMILES | FC1C=CC(N2CCNCC2)=CC1 |
| InChI | InChI=1S/C10H15FN2/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13/h1,3-4,9,12H,2,5-8H2 |
| InChIKey | PMKLTYYWPWEFKI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine?
The IUPAC name of 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine (CID 89140548) is 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine.
What is the SMILES notation for 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine?
The canonical SMILES for 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine is FC1C=CC(N2CCNCC2)=CC1.
What is the InChIKey of 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine?
The InChIKey is PMKLTYYWPWEFKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13/h1,3-4,9,12H,2,5-8H2.
What are the key properties of 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine?
1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine has a molecular weight of 182.24 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorocyclohexa-1,5-dien-1-yl)piperazine is sourced from PubChem (CID 89140548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).