About (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine
(2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine (PubChem CID 89140860) has the molecular formula C20H24N2
and a molecular weight of 292.43 g/mol. Its IUPAC name is (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine.
Molecular Properties
| Compound Name | (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine |
| PubChem CID | 89140860 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine |
| SMILES | [H]/N=C/C=C1\N(C)c2c(ccc3c(CCC)cccc23)C1(C)C |
| InChI | InChI=1S/C20H24N2/c1-5-7-14-8-6-9-16-15(14)10-11-17-19(16)22(4)18(12-13-21)20(17,2)3/h6,8-13,21H,5,7H2,1-4H3/b18-12-,21-13+ |
| InChIKey | TZORFGSWJFVOMB-LBBNCXDASA-N |
| XLogP | 5.05 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine?
The IUPAC name of (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine (CID 89140860) is (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine.
What is the SMILES notation for (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine?
The canonical SMILES for (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine is [H]/N=C/C=C1\N(C)c2c(ccc3c(CCC)cccc23)C1(C)C.
What is the InChIKey of (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine?
The InChIKey is TZORFGSWJFVOMB-LBBNCXDASA-N. The full InChI is InChI=1S/C20H24N2/c1-5-7-14-8-6-9-16-15(14)10-11-17-19(16)22(4)18(12-13-21)20(17,2)3/h6,8-13,21H,5,7H2,1-4H3/b18-12-,21-13+.
What are the key properties of (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine?
(2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine has a molecular weight of 292.43 g/mol, XLogP of 5.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(1,3,3-trimethyl-6-propylbenzo[g]indol-2-ylidene)ethanimine is sourced from PubChem (CID 89140860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).