About pentan-3-yloxymethyl propan-2-yl carbonate
pentan-3-yloxymethyl propan-2-yl carbonate (PubChem CID 89141057) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is pentan-3-yloxymethyl propan-2-yl carbonate.
Molecular Properties
| Compound Name | pentan-3-yloxymethyl propan-2-yl carbonate |
| PubChem CID | 89141057 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | pentan-3-yloxymethyl propan-2-yl carbonate |
| SMILES | CCC(CC)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C10H20O4/c1-5-9(6-2)12-7-13-10(11)14-8(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | NMHVKBTUPJHAPS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-yloxymethyl propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-yloxymethyl propan-2-yl carbonate?
The IUPAC name of pentan-3-yloxymethyl propan-2-yl carbonate (CID 89141057) is pentan-3-yloxymethyl propan-2-yl carbonate.
What is the SMILES notation for pentan-3-yloxymethyl propan-2-yl carbonate?
The canonical SMILES for pentan-3-yloxymethyl propan-2-yl carbonate is CCC(CC)OCOC(=O)OC(C)C.
What is the InChIKey of pentan-3-yloxymethyl propan-2-yl carbonate?
The InChIKey is NMHVKBTUPJHAPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-5-9(6-2)12-7-13-10(11)14-8(3)4/h8-9H,5-7H2,1-4H3.
What are the key properties of pentan-3-yloxymethyl propan-2-yl carbonate?
pentan-3-yloxymethyl propan-2-yl carbonate has a molecular weight of 204.27 g/mol, XLogP of 2.71, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-yloxymethyl propan-2-yl carbonate is sourced from PubChem (CID 89141057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).