About 6-ethoxy-4-methyl-1,2-dihydropyridine
6-ethoxy-4-methyl-1,2-dihydropyridine (PubChem CID 89141322) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 6-ethoxy-4-methyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 6-ethoxy-4-methyl-1,2-dihydropyridine |
| PubChem CID | 89141322 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 6-ethoxy-4-methyl-1,2-dihydropyridine |
| SMILES | CCOC1=CC(C)=CCN1 |
| InChI | InChI=1S/C8H13NO/c1-3-10-8-6-7(2)4-5-9-8/h4,6,9H,3,5H2,1-2H3 |
| InChIKey | HMLQJSRKALMZMU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethoxy-4-methyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-4-methyl-1,2-dihydropyridine?
The IUPAC name of 6-ethoxy-4-methyl-1,2-dihydropyridine (CID 89141322) is 6-ethoxy-4-methyl-1,2-dihydropyridine.
What is the SMILES notation for 6-ethoxy-4-methyl-1,2-dihydropyridine?
The canonical SMILES for 6-ethoxy-4-methyl-1,2-dihydropyridine is CCOC1=CC(C)=CCN1.
What is the InChIKey of 6-ethoxy-4-methyl-1,2-dihydropyridine?
The InChIKey is HMLQJSRKALMZMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-3-10-8-6-7(2)4-5-9-8/h4,6,9H,3,5H2,1-2H3.
What are the key properties of 6-ethoxy-4-methyl-1,2-dihydropyridine?
6-ethoxy-4-methyl-1,2-dihydropyridine has a molecular weight of 139.20 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-4-methyl-1,2-dihydropyridine is sourced from PubChem (CID 89141322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).