C16H19NO — CID 89141377
N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3,4-dimethylbenzamide (PubChem CID 89141377) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 89141377 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3,4-dimethylbenzamide |
| SMILES | C=C/C(=C\C=C/C)NC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H19NO/c1-5-7-8-15(6-2)17-16(18)14-10-9-12(3)13(4)11-14/h5-11H,2H2,1,3-4H3,(H,17,18)/b7-5-,15-8+ |
| InChIKey | USRTYXDIJHYLOU-VEQUYXNOSA-N |
| XLogP | 3.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|