About 1-methylisoquinoline-3,4-dicarbonitrile
1-methylisoquinoline-3,4-dicarbonitrile (PubChem CID 89141379) has the molecular formula C12H7N3
and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-methylisoquinoline-3,4-dicarbonitrile.
Molecular Properties
| Compound Name | 1-methylisoquinoline-3,4-dicarbonitrile |
| PubChem CID | 89141379 |
| Molecular Formula | C12H7N3 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 1-methylisoquinoline-3,4-dicarbonitrile |
| SMILES | Cc1nc(C#N)c(C#N)c2ccccc12 |
| InChI | InChI=1S/C12H7N3/c1-8-9-4-2-3-5-10(9)11(6-13)12(7-14)15-8/h2-5H,1H3 |
| InChIKey | XRASCIKYXNVYBI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylisoquinoline-3,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylisoquinoline-3,4-dicarbonitrile?
The IUPAC name of 1-methylisoquinoline-3,4-dicarbonitrile (CID 89141379) is 1-methylisoquinoline-3,4-dicarbonitrile.
What is the SMILES notation for 1-methylisoquinoline-3,4-dicarbonitrile?
The canonical SMILES for 1-methylisoquinoline-3,4-dicarbonitrile is Cc1nc(C#N)c(C#N)c2ccccc12.
What is the InChIKey of 1-methylisoquinoline-3,4-dicarbonitrile?
The InChIKey is XRASCIKYXNVYBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3/c1-8-9-4-2-3-5-10(9)11(6-13)12(7-14)15-8/h2-5H,1H3.
What are the key properties of 1-methylisoquinoline-3,4-dicarbonitrile?
1-methylisoquinoline-3,4-dicarbonitrile has a molecular weight of 193.21 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylisoquinoline-3,4-dicarbonitrile is sourced from PubChem (CID 89141379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).