About (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine
(Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine (PubChem CID 89141381) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine |
| PubChem CID | 89141381 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine |
| SMILES | C=C/C=C(C)\C=N/OC |
| InChI | InChI=1S/C7H11NO/c1-4-5-7(2)6-8-9-3/h4-6H,1H2,2-3H3/b7-5-,8-6- |
| InChIKey | UEUKMXUUQZOFLT-SFECMWDFSA-N |
| XLogP | 1.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine?
The IUPAC name of (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine (CID 89141381) is (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine.
What is the SMILES notation for (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine?
The canonical SMILES for (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine is C=C/C=C(C)\C=N/OC.
What is the InChIKey of (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine?
The InChIKey is UEUKMXUUQZOFLT-SFECMWDFSA-N. The full InChI is InChI=1S/C7H11NO/c1-4-5-7(2)6-8-9-3/h4-6H,1H2,2-3H3/b7-5-,8-6-.
What are the key properties of (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine?
(Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine has a molecular weight of 125.17 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2Z)-N-methoxy-2-methylpenta-2,4-dien-1-imine is sourced from PubChem (CID 89141381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).