About N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine
N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine (PubChem CID 89141386) has the molecular formula C11H20N2
and a molecular weight of 180.30 g/mol. Its IUPAC name is N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine |
| PubChem CID | 89141386 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine |
| SMILES | CCCN(CC)C1C=C(C)C=CN1 |
| InChI | InChI=1S/C11H20N2/c1-4-8-13(5-2)11-9-10(3)6-7-12-11/h6-7,9,11-12H,4-5,8H2,1-3H3 |
| InChIKey | BCDRGSJBQNBEBV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine?
The IUPAC name of N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine (CID 89141386) is N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine.
What is the SMILES notation for N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine?
The canonical SMILES for N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine is CCCN(CC)C1C=C(C)C=CN1.
What is the InChIKey of N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine?
The InChIKey is BCDRGSJBQNBEBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-4-8-13(5-2)11-9-10(3)6-7-12-11/h6-7,9,11-12H,4-5,8H2,1-3H3.
What are the key properties of N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine?
N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine has a molecular weight of 180.30 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-methyl-N-propyl-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 89141386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).