C30H48O5 — CID 89141388
2-[1-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methylperoxy]propan-2-yloxy]-7-hydroxyheptan-3-one (PubChem CID 89141388) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is 2-[1-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methylperoxy]propan-2-yloxy]-7-hydroxyheptan-3-one.
| Compound Name | 2-[1-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methylperoxy]propan-2-yloxy]-7-hydroxyheptan-3-one |
|---|---|
| PubChem CID | 89141388 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | 2-[1-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methylperoxy]propan-2-yloxy]-7-hydroxyheptan-3-one |
| SMILES | CC(COOCC1(C)CCCC2(C)c3ccc(C(C)C)cc3CCC12)OC(C)C(=O)CCCCO |
| InChI | InChI=1S/C30H48O5/c1-21(2)24-11-13-26-25(18-24)12-14-28-29(5,15-9-16-30(26,28)6)20-34-33-19-22(3)35-23(4)27(32)10-7-8-17-31/h11,13,18,21-23,28,31H,7-10,12,14-17,19-20H2,1-6H3 |
| InChIKey | HGRXGFMORVSJCJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|