C21H36O3 — CID 89141452
2-[(1R)-2-(2-tert-butyl-2,4,4-trimethylpentanoyl)cyclopropyl]ethyl 2-methylprop-2-enoate (PubChem CID 89141452) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is 2-[(1R)-2-(2-tert-butyl-2,4,4-trimethylpentanoyl)cyclopropyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(1R)-2-(2-tert-butyl-2,4,4-trimethylpentanoyl)cyclopropyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89141452 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 2-[(1R)-2-(2-tert-butyl-2,4,4-trimethylpentanoyl)cyclopropyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC[C@H]1CC1C(=O)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3/c1-14(2)18(23)24-11-10-15-12-16(15)17(22)21(9,20(6,7)8)13-19(3,4)5/h15-16H,1,10-13H2,2-9H3/t15-,16?,21?/m0/s1 |
| InChIKey | INDSYIRGTQDYBL-FQWCMUAHSA-N |
| XLogP | 5.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|