C10H19N3 — CID 89141803
N-(3,4-dihydropyridin-3-ylmethyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 89141803) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N-(3,4-dihydropyridin-3-ylmethyl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(3,4-dihydropyridin-3-ylmethyl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 89141803 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N-(3,4-dihydropyridin-3-ylmethyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCC1C=NC=CC1 |
| InChI | InChI=1S/C10H19N3/c1-13(2)7-6-12-9-10-4-3-5-11-8-10/h3,5,8,10,12H,4,6-7,9H2,1-2H3 |
| InChIKey | YRUMKRMXWRILPL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|