C40H64N2O4 — CID 89141872
(4R,5R,8R)-9-formyl-2-[4-hexyl-5-[(4-piperidin-1-ylpiperidin-1-yl)methyl]oxolan-2-yl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 89141872) has the molecular formula C40H64N2O4 and a molecular weight of 636.96 g/mol. Its IUPAC name is (4R,5R,8R)-9-formyl-2-[4-hexyl-5-[(4-piperidin-1-ylpiperidin-1-yl)methyl]oxolan-2-yl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | (4R,5R,8R)-9-formyl-2-[4-hexyl-5-[(4-piperidin-1-ylpiperidin-1-yl)methyl]oxolan-2-yl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 89141872 |
| Molecular Formula | C40H64N2O4 |
| Molecular Weight | 636.96 g/mol |
| Exact Mass | 636.49 |
| IUPAC Name | (4R,5R,8R)-9-formyl-2-[4-hexyl-5-[(4-piperidin-1-ylpiperidin-1-yl)methyl]oxolan-2-yl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CCCCCCC1CC(C23C[C@@H]4[C@H](C)CC[C@H]4C4(C=O)CC2C=C(C(C)C)C34C(=O)O)OC1CN1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C40H64N2O4/c1-5-6-7-9-12-29-21-36(46-35(29)25-41-19-15-31(16-20-41)42-17-10-8-11-18-42)39-24-32-28(4)13-14-33(32)38(26-43)23-30(39)22-34(27(2)3)40(38,39)37(44)45/h22,26-33,35-36H,5-21,23-25H2,1-4H3,(H,44,45)/t28-,29?,30?,32-,33-,35?,36?,38?,39?,40?/m1/s1 |
| InChIKey | RCAHASXULLGGOH-KEXWYJMBSA-N |
| XLogP | 7.61 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.96 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|