C33H53NO5 — CID 89141996
(4R,5R,8R)-2-[4-butyl-5-[[3-methoxypropyl(methyl)amino]methyl]oxolan-2-yl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 89141996) has the molecular formula C33H53NO5 and a molecular weight of 543.79 g/mol. Its IUPAC name is (4R,5R,8R)-2-[4-butyl-5-[[3-methoxypropyl(methyl)amino]methyl]oxolan-2-yl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | (4R,5R,8R)-2-[4-butyl-5-[[3-methoxypropyl(methyl)amino]methyl]oxolan-2-yl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 89141996 |
| Molecular Formula | C33H53NO5 |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 543.39 |
| IUPAC Name | (4R,5R,8R)-2-[4-butyl-5-[[3-methoxypropyl(methyl)amino]methyl]oxolan-2-yl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CCCCC1CC(C23C[C@@H]4[C@H](C)CC[C@H]4C4(C=O)CC2C=C(C(C)C)C34C(=O)O)OC1CN(C)CCCOC |
| InChI | InChI=1S/C33H53NO5/c1-7-8-10-23-15-29(39-28(23)19-34(5)13-9-14-38-6)32-18-25-22(4)11-12-26(25)31(20-35)17-24(32)16-27(21(2)3)33(31,32)30(36)37/h16,20-26,28-29H,7-15,17-19H2,1-6H3,(H,36,37)/t22-,23?,24?,25-,26-,28?,29?,31?,32?,33?/m1/s1 |
| InChIKey | SYEOMVKFIBBFCF-FMJUVWKXSA-N |
| XLogP | 5.84 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|