About (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate
(3,4-dichlorophenyl)methyl pyrazine-2-carboxylate (PubChem CID 891422) has the molecular formula C12H8Cl2N2O2
and a molecular weight of 283.11 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate |
| PubChem CID | 891422 |
| Molecular Formula | C12H8Cl2N2O2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)c(Cl)c1)c1cnccn1 |
| InChI | InChI=1S/C12H8Cl2N2O2/c13-9-2-1-8(5-10(9)14)7-18-12(17)11-6-15-3-4-16-11/h1-6H,7H2 |
| InChIKey | RWWXRAMNQBIQEC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate?
The IUPAC name of (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate (CID 891422) is (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate.
What is the SMILES notation for (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate?
The canonical SMILES for (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate is O=C(OCc1ccc(Cl)c(Cl)c1)c1cnccn1.
What is the InChIKey of (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate?
The InChIKey is RWWXRAMNQBIQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2N2O2/c13-9-2-1-8(5-10(9)14)7-18-12(17)11-6-15-3-4-16-11/h1-6H,7H2.
What are the key properties of (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate?
(3,4-dichlorophenyl)methyl pyrazine-2-carboxylate has a molecular weight of 283.11 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl)methyl pyrazine-2-carboxylate is sourced from PubChem (CID 891422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).