C18H26O8 — CID 89142840
[(2S,3S,4E,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-hydroxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-4-(2-oxoethylidene)oxan-3-yl] acetate (PubChem CID 89142840) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is [(2S,3S,4E,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-hydroxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-4-(2-oxoethylidene)oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4E,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-hydroxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-4-(2-oxoethylidene)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 89142840 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [(2S,3S,4E,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-hydroxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-4-(2-oxoethylidene)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C(=C/C=O)C[C@@H](C[C@@H](O)CO)O[C@@]1(O)C(C)(C)/C=C/C=O |
| InChI | InChI=1S/C18H26O8/c1-12(22)25-16-13(5-8-20)9-15(10-14(23)11-21)26-18(16,24)17(2,3)6-4-7-19/h4-8,14-16,21,23-24H,9-11H2,1-3H3/b6-4+,13-5+/t14-,15+,16+,18-/m1/s1 |
| InChIKey | NLBBVELASINATB-CTDVBUBISA-N |
| XLogP | 0.05 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|