C30H36O5 — CID 89142912
6,8-dihydroxy-3-methoxy-1,1,7-tris(3-methylbut-2-enyl)-9-methylidenexanthen-2-one (PubChem CID 89142912) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is 6,8-dihydroxy-3-methoxy-1,1,7-tris(3-methylbut-2-enyl)-9-methylidenexanthen-2-one.
| Compound Name | 6,8-dihydroxy-3-methoxy-1,1,7-tris(3-methylbut-2-enyl)-9-methylidenexanthen-2-one |
|---|---|
| PubChem CID | 89142912 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 6,8-dihydroxy-3-methoxy-1,1,7-tris(3-methylbut-2-enyl)-9-methylidenexanthen-2-one |
| SMILES | C=C1C2=C(C=C(OC)C(=O)C2(CC=C(C)C)CC=C(C)C)Oc2cc(O)c(CC=C(C)C)c(O)c21 |
| InChI | InChI=1S/C30H36O5/c1-17(2)9-10-21-22(31)15-23-26(28(21)32)20(7)27-24(35-23)16-25(34-8)29(33)30(27,13-11-18(3)4)14-12-19(5)6/h9,11-12,15-16,31-32H,7,10,13-14H2,1-6,8H3 |
| InChIKey | IMGXSFJBAINDMN-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|