C19H26Cl2N6O4S — CID 89142938
4-amino-3,5-dichloro-N-[4-[2-(hydroxyamino)imidazol-1-yl]-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]benzenesulfonamide (PubChem CID 89142938) has the molecular formula C19H26Cl2N6O4S and a molecular weight of 505.43 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[4-[2-(hydroxyamino)imidazol-1-yl]-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]benzenesulfonamide.
| Compound Name | 4-amino-3,5-dichloro-N-[4-[2-(hydroxyamino)imidazol-1-yl]-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 89142938 |
| Molecular Formula | C19H26Cl2N6O4S |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[4-[2-(hydroxyamino)imidazol-1-yl]-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]benzenesulfonamide |
| SMILES | CC1CCN(C(=O)C(CCn2ccnc2NO)NS(=O)(=O)c2cc(Cl)c(N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H26Cl2N6O4S/c1-12-2-6-26(7-3-12)18(28)16(4-8-27-9-5-23-19(27)24-29)25-32(30,31)13-10-14(20)17(22)15(21)11-13/h5,9-12,16,25,29H,2-4,6-8,22H2,1H3,(H,23,24) |
| InChIKey | XFGBOTMQAWGHOV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|