C15H19FN2O2 — CID 89143159
ethyl 2-[[(3Z)-4-amino-4-(4-fluorophenyl)buta-1,3-dien-2-yl]-methylamino]acetate (PubChem CID 89143159) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is ethyl 2-[[(3Z)-4-amino-4-(4-fluorophenyl)buta-1,3-dien-2-yl]-methylamino]acetate.
| Compound Name | ethyl 2-[[(3Z)-4-amino-4-(4-fluorophenyl)buta-1,3-dien-2-yl]-methylamino]acetate |
|---|---|
| PubChem CID | 89143159 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | ethyl 2-[[(3Z)-4-amino-4-(4-fluorophenyl)buta-1,3-dien-2-yl]-methylamino]acetate |
| SMILES | C=C(/C=C(\N)c1ccc(F)cc1)N(C)CC(=O)OCC |
| InChI | InChI=1S/C15H19FN2O2/c1-4-20-15(19)10-18(3)11(2)9-14(17)12-5-7-13(16)8-6-12/h5-9H,2,4,10,17H2,1,3H3/b14-9- |
| InChIKey | ZGXLWXHPQLCLBT-ZROIWOOFSA-N |
| XLogP | 2.13 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|