C7H8ClF — CID 89143199
(1Z,3Z)-1-chloro-2-fluoro-4-methylhexa-1,3,5-triene (PubChem CID 89143199) has the molecular formula C7H8ClF and a molecular weight of 146.59 g/mol. Its IUPAC name is (1Z,3Z)-1-chloro-2-fluoro-4-methylhexa-1,3,5-triene.
| Compound Name | (1Z,3Z)-1-chloro-2-fluoro-4-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 89143199 |
| Molecular Formula | C7H8ClF |
| Molecular Weight | 146.59 g/mol |
| Exact Mass | 146.03 |
| IUPAC Name | (1Z,3Z)-1-chloro-2-fluoro-4-methylhexa-1,3,5-triene |
| SMILES | C=C/C(C)=C\C(F)=C\Cl |
| InChI | InChI=1S/C7H8ClF/c1-3-6(2)4-7(9)5-8/h3-5H,1H2,2H3/b6-4-,7-5- |
| InChIKey | ISGLAUOCHSMFBE-PEPZGXQESA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|