C13H18FNO — CID 89143256
(3Z,6Z,8E)-2-ethoxy-8-fluoroundeca-1,3,6,8,10-pentaen-4-amine (PubChem CID 89143256) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is (3Z,6Z,8E)-2-ethoxy-8-fluoroundeca-1,3,6,8,10-pentaen-4-amine.
| Compound Name | (3Z,6Z,8E)-2-ethoxy-8-fluoroundeca-1,3,6,8,10-pentaen-4-amine |
|---|---|
| PubChem CID | 89143256 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (3Z,6Z,8E)-2-ethoxy-8-fluoroundeca-1,3,6,8,10-pentaen-4-amine |
| SMILES | C=C/C=C(F)\C=C/C/C(N)=C/C(=C)OCC |
| InChI | InChI=1S/C13H18FNO/c1-4-7-12(14)8-6-9-13(15)10-11(3)16-5-2/h4,6-8,10H,1,3,5,9,15H2,2H3/b8-6-,12-7+,13-10- |
| InChIKey | YPKFQJSMELMPPR-CRULLPDXSA-N |
| XLogP | 3.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|