C24H32N6O — CID 89143339
N-[(1Z)-2-methylbuta-1,3-dienyl]-1-[4-[(2S)-2-[2-[[5-(triazol-1-yl)-2-pyridinyl]oxy]ethyl]cyclopropyl]piperidin-1-yl]ethanimine (PubChem CID 89143339) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[(1Z)-2-methylbuta-1,3-dienyl]-1-[4-[(2S)-2-[2-[[5-(triazol-1-yl)-2-pyridinyl]oxy]ethyl]cyclopropyl]piperidin-1-yl]ethanimine.
| Compound Name | N-[(1Z)-2-methylbuta-1,3-dienyl]-1-[4-[(2S)-2-[2-[[5-(triazol-1-yl)-2-pyridinyl]oxy]ethyl]cyclopropyl]piperidin-1-yl]ethanimine |
|---|---|
| PubChem CID | 89143339 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | N-[(1Z)-2-methylbuta-1,3-dienyl]-1-[4-[(2S)-2-[2-[[5-(triazol-1-yl)-2-pyridinyl]oxy]ethyl]cyclopropyl]piperidin-1-yl]ethanimine |
| SMILES | C=C/C(C)=C\N=C(/C)N1CCC(C2C[C@H]2CCOc2ccc(-n3ccnn3)cn2)CC1 |
| InChI | InChI=1S/C24H32N6O/c1-4-18(2)16-25-19(3)29-11-7-20(8-12-29)23-15-21(23)9-14-31-24-6-5-22(17-26-24)30-13-10-27-28-30/h4-6,10,13,16-17,20-21,23H,1,7-9,11-12,14-15H2,2-3H3/b18-16-,25-19+/t21-,23?/m1/s1 |
| InChIKey | VSHHCBQWXRBMHD-GXMHNONRSA-N |
| XLogP | 4.29 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|