C18H20ClN7 — CID 89143351
2-N-[3-amino-4-(methyliminomethyl)phenyl]-5-chloro-4-N-cyclobutyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 89143351) has the molecular formula C18H20ClN7 and a molecular weight of 369.86 g/mol. Its IUPAC name is 2-N-[3-amino-4-(methyliminomethyl)phenyl]-5-chloro-4-N-cyclobutyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-amino-4-(methyliminomethyl)phenyl]-5-chloro-4-N-cyclobutyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 89143351 |
| Molecular Formula | C18H20ClN7 |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-N-[3-amino-4-(methyliminomethyl)phenyl]-5-chloro-4-N-cyclobutyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | C/N=C/c1ccc(Nc2nc(NC3CCC3)c3c(Cl)c[nH]c3n2)cc1N |
| InChI | InChI=1S/C18H20ClN7/c1-21-8-10-5-6-12(7-14(10)20)24-18-25-16-15(13(19)9-22-16)17(26-18)23-11-3-2-4-11/h5-9,11H,2-4,20H2,1H3,(H3,22,23,24,25,26)/b21-8+ |
| InChIKey | UNKWDMMZUSOOJJ-ODCIPOBUSA-N |
| XLogP | 3.95 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|