C9H16N2 — CID 89143372
7-ethyl-1,2,3,4,6,7-hexahydropyrrolo[1,2-a]pyrazine (PubChem CID 89143372) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 7-ethyl-1,2,3,4,6,7-hexahydropyrrolo[1,2-a]pyrazine.
| Compound Name | 7-ethyl-1,2,3,4,6,7-hexahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 89143372 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 7-ethyl-1,2,3,4,6,7-hexahydropyrrolo[1,2-a]pyrazine |
| SMILES | CCC1C=C2CNCCN2C1 |
| InChI | InChI=1S/C9H16N2/c1-2-8-5-9-6-10-3-4-11(9)7-8/h5,8,10H,2-4,6-7H2,1H3 |
| InChIKey | XNDQTTRLVHMPLQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |