C21H27NO2 — CID 891434
N-benzyl-N-tert-butyl-2-(2,4-dimethylphenoxy)acetamide (PubChem CID 891434) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is N-benzyl-N-tert-butyl-2-(2,4-dimethylphenoxy)acetamide.
| Compound Name | N-benzyl-N-tert-butyl-2-(2,4-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 891434 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | N-benzyl-N-tert-butyl-2-(2,4-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)N(Cc2ccccc2)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C21H27NO2/c1-16-11-12-19(17(2)13-16)24-15-20(23)22(21(3,4)5)14-18-9-7-6-8-10-18/h6-13H,14-15H2,1-5H3 |
| InChIKey | HRPPWBNOACGILD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |