C6H10N2O2S — CID 89143646
(1Z,3E)-1-aminohexa-1,3,5-triene-3-sulfonamide (PubChem CID 89143646) has the molecular formula C6H10N2O2S and a molecular weight of 174.23 g/mol. Its IUPAC name is (1Z,3E)-1-aminohexa-1,3,5-triene-3-sulfonamide.
| Compound Name | (1Z,3E)-1-aminohexa-1,3,5-triene-3-sulfonamide |
|---|---|
| PubChem CID | 89143646 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (1Z,3E)-1-aminohexa-1,3,5-triene-3-sulfonamide |
| SMILES | C=C/C=C(\C=C/N)S(N)(=O)=O |
| InChI | InChI=1S/C6H10N2O2S/c1-2-3-6(4-5-7)11(8,9)10/h2-5H,1,7H2,(H2,8,9,10)/b5-4-,6-3+ |
| InChIKey | NTJRLKNDYBEBPI-XNYOYJNRSA-N |
| XLogP | -0.18 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|