C8H13NO2 — CID 89143649
(1Z,3Z)-3,4-dimethoxyhexa-1,3,5-trien-1-amine (PubChem CID 89143649) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (1Z,3Z)-3,4-dimethoxyhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-3,4-dimethoxyhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89143649 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (1Z,3Z)-3,4-dimethoxyhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(OC)=C(\C=C/N)OC |
| InChI | InChI=1S/C8H13NO2/c1-4-7(10-2)8(11-3)5-6-9/h4-6H,1,9H2,2-3H3/b6-5-,8-7- |
| InChIKey | MTRGKKNJYGKNBU-ISTTXYCBSA-N |
| XLogP | 1.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|