C7H10FNO — CID 89143650
(1Z,3Z)-3-fluoro-4-methoxyhexa-1,3,5-trien-1-amine (PubChem CID 89143650) has the molecular formula C7H10FNO and a molecular weight of 143.16 g/mol. Its IUPAC name is (1Z,3Z)-3-fluoro-4-methoxyhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-3-fluoro-4-methoxyhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89143650 |
| Molecular Formula | C7H10FNO |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | (1Z,3Z)-3-fluoro-4-methoxyhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(OC)=C(F)\C=C/N |
| InChI | InChI=1S/C7H10FNO/c1-3-7(10-2)6(8)4-5-9/h3-5H,1,9H2,2H3/b5-4-,7-6- |
| InChIKey | CHBZWOBONSVHIP-RZSVFLSASA-N |
| XLogP | 1.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|