C18H20FN5O3 — CID 8914376
2-(2-fluorophenoxy)ethyl 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate (PubChem CID 8914376) has the molecular formula C18H20FN5O3 and a molecular weight of 373.39 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
|---|---|
| PubChem CID | 8914376 |
| Molecular Formula | C18H20FN5O3 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
| SMILES | Cc1nc2nc(N)nn2c(C)c1CCC(=O)OCCOc1ccccc1F |
| InChI | InChI=1S/C18H20FN5O3/c1-11-13(12(2)24-18(21-11)22-17(20)23-24)7-8-16(25)27-10-9-26-15-6-4-3-5-14(15)19/h3-6H,7-10H2,1-2H3,(H2,20,23) |
| InChIKey | IZRMFFWXARVMJP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|