C14H14N2O3 — CID 89143790
2-[(9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]benzaldehyde (PubChem CID 89143790) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-[(9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]benzaldehyde.
| Compound Name | 2-[(9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]benzaldehyde |
|---|---|
| PubChem CID | 89143790 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-[(9R)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl]benzaldehyde |
| SMILES | O=Cc1ccccc1[C@H]1CCCC12NC(=O)NC2=O |
| InChI | InChI=1S/C14H14N2O3/c17-8-9-4-1-2-5-10(9)11-6-3-7-14(11)12(18)15-13(19)16-14/h1-2,4-5,8,11H,3,6-7H2,(H2,15,16,18,19)/t11-,14?/m1/s1 |
| InChIKey | HEZJIFGQDRSHHY-YNODCEANSA-N |
| XLogP | 1.34 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|