C19H40O3Si2 — CID 89143888
trans-(3S,5S)-3,5-bis[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4-methylidenecyclohexan-1-ol (PubChem CID 89143888) has the molecular formula C19H40O3Si2 and a molecular weight of 372.70 g/mol. Its IUPAC name is trans-(3S,5S)-3,5-bis[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4-methylidenecyclohexan-1-ol.
| Compound Name | trans-(3S,5S)-3,5-bis[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 89143888 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | trans-(3S,5S)-3,5-bis[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1[C@H](CC(C)(C)[Si](C)(C)O)CC(O)C[C@H]1CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C19H40O3Si2/c1-14-15(12-18(2,3)23(6,7)21)10-17(20)11-16(14)13-19(4,5)24(8,9)22/h15-17,20-22H,1,10-13H2,2-9H3/t15-,16-/m0/s1 |
| InChIKey | NKIFAFLTTVATQV-HOTGVXAUSA-N |
| XLogP | 4.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|