C23H48O5 — CID 89143933
(2R,3R,4R,5S)-1,3,4,5-tetrabutoxy-2-methoxyhexane (PubChem CID 89143933) has the molecular formula C23H48O5 and a molecular weight of 404.63 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1,3,4,5-tetrabutoxy-2-methoxyhexane.
| Compound Name | (2R,3R,4R,5S)-1,3,4,5-tetrabutoxy-2-methoxyhexane |
|---|---|
| PubChem CID | 89143933 |
| Molecular Formula | C23H48O5 |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.35 |
| IUPAC Name | (2R,3R,4R,5S)-1,3,4,5-tetrabutoxy-2-methoxyhexane |
| SMILES | CCCCOC[C@@H](OC)[C@@H](OCCCC)[C@H](OCCCC)[C@H](C)OCCCC |
| InChI | InChI=1S/C23H48O5/c1-7-11-15-25-19-21(24-6)23(28-18-14-10-4)22(27-17-13-9-3)20(5)26-16-12-8-2/h20-23H,7-19H2,1-6H3/t20-,21+,22+,23+/m0/s1 |
| InChIKey | PPJKKGCBSHOAFS-WBADGQHESA-N |
| XLogP | 5.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|