C36H51FO7 — CID 89143969
phenyl-[2-[(3S,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-2-fluoro-1,8-dioxaspiro[2.5]octan-2-yl]phenyl]methanone (PubChem CID 89143969) has the molecular formula C36H51FO7 and a molecular weight of 614.80 g/mol. Its IUPAC name is phenyl-[2-[(3S,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-2-fluoro-1,8-dioxaspiro[2.5]octan-2-yl]phenyl]methanone.
| Compound Name | phenyl-[2-[(3S,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-2-fluoro-1,8-dioxaspiro[2.5]octan-2-yl]phenyl]methanone |
|---|---|
| PubChem CID | 89143969 |
| Molecular Formula | C36H51FO7 |
| Molecular Weight | 614.80 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | phenyl-[2-[(3S,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-2-fluoro-1,8-dioxaspiro[2.5]octan-2-yl]phenyl]methanone |
| SMILES | CCCCOC[C@H]1O[C@]2(OC2(F)c2ccccc2C(=O)c2ccccc2)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C36H51FO7/c1-5-9-22-39-26-30-32(40-23-10-6-2)33(41-24-11-7-3)34(42-25-12-8-4)36(43-30)35(37,44-36)29-21-17-16-20-28(29)31(38)27-18-14-13-15-19-27/h13-21,30,32-34H,5-12,22-26H2,1-4H3/t30-,32-,33+,34-,35?,36+/m1/s1 |
| InChIKey | UVQSJXXQOIEEBE-RVKCBSHQSA-N |
| XLogP | 7.54 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.80 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|