C19H21N3O — CID 89144015
6-[2-(3-aminophenyl)ethynyl]-N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyridin-2-amine (PubChem CID 89144015) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 6-[2-(3-aminophenyl)ethynyl]-N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyridin-2-amine.
| Compound Name | 6-[2-(3-aminophenyl)ethynyl]-N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 89144015 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 6-[2-(3-aminophenyl)ethynyl]-N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyridin-2-amine |
| SMILES | C=C(Nc1cccc(C#Cc2cccc(N)c2)n1)OC(C)(C)C |
| InChI | InChI=1S/C19H21N3O/c1-14(23-19(2,3)4)21-18-10-6-9-17(22-18)12-11-15-7-5-8-16(20)13-15/h5-10,13H,1,20H2,2-4H3,(H,21,22) |
| InChIKey | XSBWRYJNXMXMRV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|