C16H24N8O3 — CID 89144669
6-(2-hydroxyethyl)-4-(2-nitrosoethyl)-5-[4-(2,4,6-triaminopyrimidin-5-yl)butyl]-1H-pyrimidin-2-one (PubChem CID 89144669) has the molecular formula C16H24N8O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 6-(2-hydroxyethyl)-4-(2-nitrosoethyl)-5-[4-(2,4,6-triaminopyrimidin-5-yl)butyl]-1H-pyrimidin-2-one.
| Compound Name | 6-(2-hydroxyethyl)-4-(2-nitrosoethyl)-5-[4-(2,4,6-triaminopyrimidin-5-yl)butyl]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 89144669 |
| Molecular Formula | C16H24N8O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 6-(2-hydroxyethyl)-4-(2-nitrosoethyl)-5-[4-(2,4,6-triaminopyrimidin-5-yl)butyl]-1H-pyrimidin-2-one |
| SMILES | Nc1nc(N)c(CCCCc2c(CCN=O)nc(=O)[nH]c2CCO)c(N)n1 |
| InChI | InChI=1S/C16H24N8O3/c17-13-10(14(18)24-15(19)23-13)4-2-1-3-9-11(5-7-20-27)21-16(26)22-12(9)6-8-25/h25H,1-8H2,(H,21,22,26)(H6,17,18,19,23,24) |
| InChIKey | HNIKTZJAORXBQU-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 199.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|