About N,N-dihydroxy-2,6-dimethylaniline
N,N-dihydroxy-2,6-dimethylaniline (PubChem CID 89145253) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is N,N-dihydroxy-2,6-dimethylaniline.
Molecular Properties
| Compound Name | N,N-dihydroxy-2,6-dimethylaniline |
| PubChem CID | 89145253 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | N,N-dihydroxy-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1N(O)O |
| InChI | InChI=1S/C8H11NO2/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5,10-11H,1-2H3 |
| InChIKey | HXKOOZTVKPAUEI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dihydroxy-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dihydroxy-2,6-dimethylaniline?
The IUPAC name of N,N-dihydroxy-2,6-dimethylaniline (CID 89145253) is N,N-dihydroxy-2,6-dimethylaniline.
What is the SMILES notation for N,N-dihydroxy-2,6-dimethylaniline?
The canonical SMILES for N,N-dihydroxy-2,6-dimethylaniline is Cc1cccc(C)c1N(O)O.
What is the InChIKey of N,N-dihydroxy-2,6-dimethylaniline?
The InChIKey is HXKOOZTVKPAUEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5,10-11H,1-2H3.
What are the key properties of N,N-dihydroxy-2,6-dimethylaniline?
N,N-dihydroxy-2,6-dimethylaniline has a molecular weight of 153.18 g/mol, XLogP of 1.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dihydroxy-2,6-dimethylaniline is sourced from PubChem (CID 89145253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).